| Identification | |
| Name: | 2(3H)-Furanone,dihydro-5-propyl- |
| Synonyms: | Enanthicacid, g-hydroxy-, lactone (4CI);Heptanoic acid, 4-hydroxy-, g-lactone (6CI,7CI);(RS)-g-Heptalactone;4-Heptanolide;4-Hydroxyheptanoic acid lactone;4-Propyl-4-butanolide;Dihydro-5-propyl-2(3H)-furanone;NSC 46097;NSC 46352;Tetrahydro-5-propyl-2-furanone;g-Heptalactone;g-Heptanolactone;g-Propiobutyrolactone;g-Propyl-g-butyrolactone; |
| CAS: | 105-21-5 |
| EINECS: | 203-279-9 |
| Molecular Formula: | C7H12O2 |
| Molecular Weight: | 128.17 |
| InChI: | InChI=1/C7H12O2/c1-2-3-6-4-5-7(8)9-6/h6H,2-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.999 |
| Refractive index: | 1.445 |
| Water Solubility: | miscible with alcohol and most fixed oils |
| Solubility: | miscible with alcohol and most fixed oils |
| Appearance: | Colorless or light yellowish liquid. |
| Specification: | Clear colorless to pale yellow liquid Safety Statements:36 36:Wear suitable protective clothing |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
