| Identification | |
| Name: | Ethyl propionate |
| Synonyms: | Propanoic acid ethyl ester; Propionic acid ethyl ester; ETHYL PROPIONATE; NATURAL ETHYL PROPIONATE |
| CAS: | 105-37-3 |
| EINECS: | 203-291-4 |
| Molecular Formula: | C5H10O2 |
| Molecular Weight: | 102.13 |
| InChI: | InChI=1/C5H10O2/c1-3-5(6)7-4-2/h3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1195 |
| Density: | 0.887 |
| Refractive index: | 1.383-1.387 |
| Solubility: | 25 g/L (15 oC) |
| Appearance: | Colourless liquid with a fruity, rum-like, ethereal odour |
| Specification: | clear colorless to pale yellow liquid Safety Statements:16-23-24-29-33 16:Keep away from sources of ignition - No smoking 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 24:Avoid contact with skin 29:Do not empty into drains 33:Take precautionary measures against static discharges |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Color: | Colorless liquid Water-white liquid |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
