| Identification | |
| Name: | 3-Methylpentanoic acid |
| Synonyms: | Valericacid, 3-methyl- (6CI,7CI,8CI); Valeric acid, b-methyl- (4CI); 3-Methyl-n-valeric acid;3-Methylpentanoic acid; 3-Methylvaleric acid; b-Methylvaleric acid |
| CAS: | 105-43-1 |
| EINECS: | 203-297-7 |
| Molecular Formula: | C6H12O2 |
| Molecular Weight: | 116.16 |
| InChI: | InChI=1/C6H12O2/c1-3-5(2)4-6(7)8/h5H,3-4H2,1-2H3,(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 |
| Density: | 0.928 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.414-1.418 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | Colorless liquid. With a stench. |
| Specification: | clear colorless to slightly yellow liquid Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | II |
| HS Code: | 29159080 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
