| Identification | |
| Name: | Acetal |
| Synonyms: | Acetal~1,1-Diethoxyethane; diethylacetal; 1,1-Diethoxyacetal; 1,1-diethoxyethane; Acetaldehyde diethyl acetal; Diethyl acetal; Capsicum annuum l.; Ethylidine diethyl ether; Ethylidene diethyl ether; Acetaldehydeliethylacetal |
| CAS: | 105-57-7 |
| EINECS: | 203-310-6 |
| Molecular Formula: | C6H14O2 |
| Molecular Weight: | 118.17 |
| InChI: | InChI=1/C6H14O2/c1-4-7-6(3)8-5-2/h6H,4-5H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1088 |
| Density: | 0.825 |
| Stability: | Stable. Highly flammable. May form peroxides in storage. Test for peroxides before use. Vapors may form an explosive mixture with air, and may travel to source of ignition and flash back. Vapors may spread along ground and collect in low or confined areas (sewers, basements, tanks). |
| Refractive index: | 1.379-1.385 |
| Solubility: | 46 g/L (25 oC) |
| Appearance: | Colorless liquid, pungent, green woody solvent odor. |
| Specification: | clear, colorless liquid Safety Statements:9-16-33 9:Keep container in a well-ventilated place 16:Keep away from sources of ignition - No smoking 33:Take precautionary measures against static discharges |
| Packinggroup: | II |
| HS Code: | 29110000 |
| Color: | COLORLESS LIQUID |
| Usage: | Solvent, in organic syntheses, formerly hypnotic. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
