| Identification | |
| Name: | 3,3'-diamino-N-methyldipropylamine |
| Synonyms: | N,N-Bis(3-aminopropyl)methylamine~3,3-Diamino-N-methyldi-n-propylamine; Merhyliminobispropylamine; 3,3-Methyliminobis-n-propylamine |
| CAS: | 105-83-9 |
| EINECS: | 203-336-8 |
| Molecular Formula: | C7H19N3 |
| Molecular Weight: | 145.25 |
| InChI: | InChI=1/C7H19N3/c1-10(6-2-4-8)7-3-5-9/h2-9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Melting Point: | -30--28°C |
| Density: | 0.901 |
| Refractive index: | 1.4725 |
| Specification: | Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
