| Identification | |
| Name: | 2,6-Octadien-1-ol,3,7-dimethyl-, 1-propanoate, (2E)- |
| Synonyms: | 2,6-Octadien-1-ol,3,7-dimethyl-, propanoate, (2E)- (9CI);2,6-Octadien-1-ol, 3,7-dimethyl-,propanoate, (E)-;2,6-Octadien-1-ol, 3,7-dimethyl-, propionate, (E)- (8CI);Propionic acid, geranyl ester (6CI);(E)-3,7-Dimethyl-2,6-octadien-1-olpropanoate;Geraniol propanoate;Geraniol propionate;Geranyl propanoate;trans-3,7-Dimethyl-2,6-octadienyl propionate; |
| CAS: | 105-90-8 |
| EINECS: | 203-344-1 |
| Molecular Formula: | C13H22O2 |
| Molecular Weight: | 210.31 |
| InChI: | InChI=1/C13H22O2/c1-5-13(14)15-10-9-12(4)8-6-7-11(2)3/h7,9H,5-6,8,10H2,1-4H3/b12-9+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 113 ºC |
| Boiling Point: | 252 ºC738 mm Hg(lit.) |
| Density: | 0.899 |
| Refractive index: | 1.456 |
| Specification: |
The chemical synonyms of 3,7-Dimethylocta-2,6-dienyl propanoate (105-90-8) are 3,7-Dimethyl-2,6-octadien-1-yl n-propionate ; 2,6-Dimethyl octadien-6-yl-8-n-propionate ; Geranyl propionate ; Fema 2517 ; (2Z)-3,7-Dimethyl-2,6-octadienyl propionate ; (e)-3,7-Dimethyl-2,6-octadien-1-olpropionate ; 2,6-Octadien-1-o1, 3,7-dimethyl-, propanoate, (E)- . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 113 ºC |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
