| Identification | |
| Name: | Ethylene brassylate |
| Synonyms: | Cyclic ethylenetridecanedioate;Emeressence 1150;1,4-Dioxacycloheptadecane-5,17-dione;Musk T;NSC 46155;Tridecanedioicacid, cyclic ethylene ester (7CI,8CI);Ethylene glycol, cyclic tridecanedioate(8CI);Astratone;Cyclic ethylene glycol tridecanedioate; |
| CAS: | 105-95-3 |
| EINECS: | 203-347-8 |
| Molecular Formula: | C15H26O4 |
| Molecular Weight: | 270.37 |
| InChI: | InChI=1/C15H26O4/c16-14-10-8-6-4-2-1-3-5-7-9-11-15(17)19-13-12-18-14/h1-13H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 200? |
| Density: | 1.042 |
| Refractive index: | 1.47 |
| Water Solubility: | Insoluble (soluble in alcohol) IN WATER |
| Solubility: | Insoluble (soluble in alcohol) IN WATER |
| Appearance: | colorless to pale yellow liquid |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 200? |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
