| Identification | |
| Name: | Cresyl violet acetate |
| Synonyms: | 3,7-Diaminobenzo[b]phenoxazinylium acetate;5H-benzo[a]phenoxazin-9-amine, 5-imino-, acetate (1:1);9-Amino-5H-benzo[a]phenoxazin-5-iminium acetate; |
| CAS: | 10510-54-0 |
| EINECS: | 234-043-3 |
| Molecular Formula: | C16H12N3O.C2H3O2 |
| Molecular Weight: | 321.33 |
| InChI: | InChI=1S/C16H11N3O.C2H4O2/c17-9-5-6-13-14(7-9)20-15-8-12(18)10-3-1-2-4-11(10)16(15)19-13;1-2(3)4/h1-8,18H,17H2;1H3,(H,3,4) |
| Molecular Structure: | ![(C16H12N3O.C2H3O2) 3,7-Diaminobenzo[b]phenoxazinylium acetate;5H-benzo[a]phenoxazin-9-amine, 5-imino-, acetate (1:1);9-...](https://img.guidechem.com/crawlimg/10510-54-0.gif) |
| Properties | |
| Melting Point: | 142 ºC |
| Flash Point: | 237 ºC |
| Boiling Point: | 468.3 ºC |
| Density: | g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | appreciable |
| Solubility: | appreciable |
| Appearance: | green crystals |
| Specification: | green crystals Safety Statements:37/39-26 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 237 ºC |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
