| Identification | |
| Name: | 2,3-Pyridinedicarboxylicacid, 5-ethyl-, 2,3-diethyl ester |
| Synonyms: | 2,3-Pyridinedicarboxylicacid, 5-ethyl-, diethyl ester (9CI);Diethyl 5-ethylpyridine-2,3-dicarboxylate; |
| CAS: | 105151-39-1 |
| Molecular Formula: | C13H17NO4 |
| Molecular Weight: | 251.28 |
| InChI: | InChI=1/C13H17NO4/c1-4-9-7-10(12(15)17-5-2)11(14-8-9)13(16)18-6-3/h7-8H,4-6H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 166.4°C |
| Boiling Point: | 351.6°Cat760mmHg |
| Density: | 1.12g/cm3 |
| Refractive index: | 1.507 |
| Appearance: | white crystal |
| Specification: |
2,3-Pyridinedicarboxylicacid, 5-ethyl-, 2,3-diethyl ester , its cas register number is 105151-39-1. It also can be called 5-Ethylpyridine-2,3-dicarboxylic acid diethyl ester ; 5-Ethylquinolinic acid diethyl ester ; Diethyl 5-ethyl-2,3-pyridinedicarboxylate ; Diethyl 5-ethylpyridine-2,3-dicarboxylate ; and Diethyl 5-ethylquinolinate . |
| Flash Point: | 166.4°C |
| Safety Data | |
| Hazard Symbols |
F: Flammable
|
 |
|
