| Identification | |
| Name: | 2-(2-Bromoacetyl)thiophene |
| Synonyms: | Ketone,bromomethyl 2-thienyl (7CI,8CI);(a-Bromoacetyl)thiophene;2-(Bromoacetyl)thiophene;2-Bromo-1-(2-thienyl)ethan-1-one;2-Bromo-1-thien-2-ylethanone;2-Bromo-1-thiophen-2-ylethanone;Bromomethyl2-thienyl ketone;Bromomethyl a-thienyl ketone;a-Bromo-2-acetylthiophene;Ethanone,2-bromo-1-(2-thienyl)-; |
| CAS: | 10531-41-6 |
| Molecular Formula: | C6H5BrOS |
| Molecular Weight: | 205.07 |
| InChI: | InChI=1/C6H5BrOS/c7-4-5(8)6-2-1-3-9-6/h1-3H,4H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 8/PG 2 |
| Density: | 1.658g/cm3 |
| Refractive index: | 1.601 |
| Appearance: | white to light yellow crystal powder |
| Specification: |
2-Bromo-1-thiophen-2-yl-ethanone with cas registry number of 10531-41-6 is also known as 2-Bromo-1-(2-thienyl)-1-ethanone ; 2-Bromo-1-(2-thienyl)ethanone ; Ethanone, 2-bromo-1-(2-thienyl)- ; 2-(2-Bromoacetyl)thiophene ; 2-(2-Bromoacetyl)thiophene 97% ; 2-(Bromoacetyl)thiophene ; 2-Bromo-1-thien-2-ylethanone . It is a compound with the appearance of white to light yellow crystal powder. |
| Storage Temperature: | Keep Cold |
| Sensitive: | Stench |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
T: Toxic
|
 |
|
