| Identification | |
| Name: | Ethanone,2-bromo-1-(5-phenyl-2-thienyl)- |
| Synonyms: | Ketone,bromomethyl 5-phenyl-2-thienyl (7CI,8CI);2-Bromo-1-(5-phenyl-2-thienyl)-1-ethanone;2-(Bromoacetyl)-5-phenylthiophene; |
| CAS: | 10531-43-8 |
| Molecular Formula: | C12H9BrOS |
| Molecular Weight: | 281.17 |
| InChI: | InChI=1/C12H9BrOS/c13-8-10(14)12-7-6-11(15-12)9-4-2-1-3-5-9/h1-7H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 115 °C |
| Flash Point: | 200°C |
| Boiling Point: | 407.1°Cat760mmHg |
| Density: | 1.488g/cm3 |
| Refractive index: | 1.627 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 200°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
