| Identification | |
| Name: | 2-Propenoic acid,3-(2,5-dimethoxyphenyl)- |
| Synonyms: | Cinnamicacid, 2,5-dimethoxy- (6CI,7CI,8CI);3-(2,5-Dimethoxyphenyl)acrylic acid; |
| CAS: | 10538-51-9 |
| EINECS: | 234-114-9 |
| Molecular Formula: | C11H12O4 |
| Molecular Weight: | 208.21 |
| InChI: | InChI=1/C11H12O4/c1-14-9-4-5-10(15-2)8(7-9)3-6-11(12)13/h3-7H,1-2H3,(H,12,13)/b6-3+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.203 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Solubility: | Very soluble |
| Appearance: | yellow Solid |
| Specification: | yellow powder Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
