| Identification | |
| Name: | 1H-Indazole,5-bromo-6-fluoro- |
| Synonyms: | 5-Bromo-6-fluoro-1H-indazole |
| CAS: | 105391-70-6 |
| Molecular Formula: | C7H4 Br F N2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C7H4BrFN2/c8-5-1-4-3-10-11-7(4)2-6(5)9/h1-3H,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.861 |
| Refractive index: | 1.693 |
| Specification: |
The CAS register number of 5-Bromo-6-fluoro-1H-indazole is 105391-70-6. It also can be called as 1H-Indazole,5-bromo-6-fluoro- and the systematic name about this chemical is 5-bromo-6-fluoro-1H-indazole. Physical properties about 5-Bromo-6-fluoro-1H-indazole are: (1)ACD/LogP: 2.19; (2)ACD/LogD (pH 5.5): 2.194; (3)ACD/LogD (pH 7.4): 2.194; (4)ACD/BCF (pH 5.5): 27.393; (5)ACD/BCF (pH 7.4): 27.392; (6)ACD/KOC (pH 5.5): 372.115; (7)ACD/KOC (pH 7.4): 372.106; (8)#H bond acceptors: 2; (9)#H bond donors: 1; (10)Polar Surface Area: 28.68Å2; (11)Index of Refraction: 1.693; (12)Molar Refractivity: 44.304 cm3; (13)Molar Volume: 115.49 cm3; (14)Polarizability: 17.563x10-24cm3; (15)Surface Tension: 60.79 dyne/cm; (16)Enthalpy of Vaporization: 55.213 kJ/mol; (17)Boiling Point: 332.199 °C at 760 mmHg. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
