| Identification | |
| Name: | [1,1'-Biphenyl]-4-carbonitrile,4'-fluoro- |
| Synonyms: | 4-Biphenylcarbonitrile,4'-fluoro- (7CI,8CI);4-Cyano-4'-fluorobiphenyl;4'-Fluoro-1,1'-biphenyl-4-carbonitrile; |
| CAS: | 10540-31-5 |
| Molecular Formula: | C13H8FN |
| Molecular Weight: | 197.21 |
| InChI: | InChI=1/C13H8FN/c14-13-7-5-12(6-8-13)11-3-1-10(9-15)2-4-11/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 |
| Density: | 1.19g/cm3 |
| Refractive index: | 1.595 |
| Specification: | Safety Statements:26-39-60-61 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 39:Wear eye/face protection 60:This material and/or its container must be disposed of as hazardous waste 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Safety Data | |
 |
|
