| Identification |
| Name: | Ethanone,1-(4-octylphenyl)- |
| Synonyms: | Acetophenone,4'-octyl- (6CI,7CI,8CI);4'-Octylacetophenone;NSC 168987;p-Octylacetophenone; |
| CAS: | 10541-56-7 |
| Molecular Formula: | C16H24O |
| Molecular Weight: | 232.36 |
| InChI: | InChI=1/C16H24O/c1-3-4-5-6-7-8-9-15-10-12-16(13-11-15)14(2)17/h10-13H,3-9H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 22ºC |
| Density: | 0.919 g/cm3 |
| Refractive index: | 1.494 |
| Water Solubility: | Nonsoluble in water. Soluble in hexane, ethanol and 2-propanol, highly soluble in acetone, toluene, dichloromethane |
| Solubility: | Nonsoluble in water. Soluble in hexane, ethanol and 2-propanol, highly soluble in acetone, toluene, dichloromethane |
| Appearance: | Low melting colorless to light yellow solid, aromatic odor |
| Safety Data |
| |
 |
