| Identification | |
| Name: | 2-Butenoic acid, ethylester |
| Synonyms: | Crotonicacid, ethyl ester (6CI,8CI);Ethyl 2-butenoate;NSC 4778; |
| CAS: | 10544-63-5 |
| EINECS: | 210-808-7 |
| Molecular Formula: | C6H10O2 |
| Molecular Weight: | 114.1424 |
| InChI: | InChI=1S/C6H10O2/c1-3-5-6(7)8-4-2/h3,5H,4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1862 3/PG 2 |
| Flash Point: | 28.3°C |
| Boiling Point: | 138°Cat760mmHg |
| Density: | 0.915g/cm3 |
| Refractive index: | n20/D 1.424(lit.) |
| Appearance: | clear colorless liquid |
| Specification: | clear colorless liquid Safety Statements:16-26-36/37/39-45 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Flash Point: | 28.3°C |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
F: Flammable
C: Corrosive
|
 |
|
