| Identification | |
| Name: | Propanoic acid,3-amino-2-methyl- |
| CAS: | 10569-72-9 |
| EINECS: | 234-154-7 |
| Molecular Formula: | C4H9NO2 |
| Molecular Weight: | 103.12 |
| InChI: | InChI=1/C4H9NO2/c1-3(2-5)4(6)7/h3H,2,5H2,1H3,(H,6,7) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.105 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.462 |
| Solubility: | Very soluble |
| Appearance: | White crystal or crystalline powder |
| Specification: | Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
 |
|
