| Identification | |
| Name: | Phenol,4-iodo-2,6-dimethyl- |
| Synonyms: | 2,6-Xylenol,4-iodo- (6CI,7CI,8CI);2,6-Dimethyl-4-iodophenol;4-Iodo-2,6-dimethylphenol;4-Iodo-2,6-methylphenol;4-Iodo-2,6-xylenol; |
| CAS: | 10570-67-9 |
| Molecular Formula: | C8H9IO |
| Molecular Weight: | 248.06 |
| InChI: | InChI=1/C8H9IO/c1-5-3-7(9)4-6(2)8(5)10/h3-4,10H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.74 g/cm3 |
| Refractive index: | 1.629 |
| Appearance: | Yellow white crystallization powder |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
