| Identification | |
| Name: | Ethanimidic acid,N-hydroxy-, ethyl ester |
| Synonyms: | Acetohydroximicacid, ethyl ester (8CI);Ethyl acetate, oxime (7CI);EthylN-hydroxyacetimidate;Ethyl acetohydroxamate;Ethyl acetohydroximate;N-Hydroxyacetimidic acid ethyl ester;NSC 255004; |
| CAS: | 10576-12-2 |
| EINECS: | 234-165-7 |
| Molecular Formula: | C4H9NO2 |
| Molecular Weight: | 103.12 |
| InChI: | InChI=1/C4H9NO2/c1-3-7-4(2)5-6/h6H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.99 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4325-1.4345 |
| Water Solubility: | may decompose |
| Solubility: | may decompose |
| Appearance: | white solid. |
| Specification: |
Ethyl acetohydroxamate , its cas register number is 10576-12-2. It also can be called Ethyl N-hydroxyacetimidate ; N-Hydroxyethanimidic acid, ethyl ester ; Ethanimidic acid, N-hydroxy-, ethyl ester .It is a clear colorless liquid after melting. |
| Storage Temperature: | 2-8°C |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
