| Identification |
| Name: | 2-Furancarbothioicacid, anhydrosulfide with O-decyl hydrogen carbonodithioate |
| Synonyms: | 2-Furancarbothioic acid, anhydrosulfide with O-decyl hydrogen carbonodithioate;Carbonic acid, dithio-, anhydrosulfide with thio-2-furoic acid, O-decyl ester;AC1MI8KJ;LS-51995;O-decyl furan-2-carbonylsulfanylmethanethioate;105770-10-3 |
| CAS: | 105770-10-3 |
| Molecular Formula: | C16H24 O3 S2 |
| Molecular Weight: | 328.49 |
| InChI: | InChI=1/C16H24O3S2/c1-2-3-4-5-6-7-8-9-12-19-16(20)21-15(17)14-11-10-13-18-14/h10-11,13H,2-9,12H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 204°C |
| Boiling Point: | 413.7°C at 760 mmHg |
| Density: | 1.116g/cm3 |
| Refractive index: | 1.537 |
| Flash Point: | 204°C |
| Safety Data |
| |
 |
