| Identification | |
| Name: | (3S,4R)-4-(4-Fluorophenyl)-3-hydroxymethyl-1-methylpiperidine |
| Synonyms: | (3S,4R)-4-(4'-Fluorophenyl)-3-hydroxymethyl-1-methylpiperidine; (-)trans-4-(4-fluorophenyl)-3-hydroxymethyl-1-methyl piperidine; 3-Piperidinemethanol,4-(4-fluorophenyl)-1-methyl-,(3S,4R)-; (-)Trans-4-(4-Fluorophenyl)-3-hydroxymethyl-1-methylpiperidine |
| CAS: | 105812-81-5 |
| EINECS: | 406-030-4 |
| Molecular Formula: | C13H18FNO |
| Molecular Weight: | 223.29 |
| InChI: | InChI=1/C13H18FNO/c1-15-7-6-13(11(8-15)9-16)10-2-4-12(14)5-3-10/h2-5,11,13,16H,6-9H2,1H3/t11-,13-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN3077 |
| Density: | 1.092g/cm3 |
| Refractive index: | 1.518 |
| Alpha: | -38 o (C=1, MEOH) |
| Appearance: | white to light yellow crystal powder |
| Specification: |
??3-Piperidinemethanol,4-(4-fluorophenyl)-1-methyl-, (3S,4R)- ,?its cas register number is 105812-81-5. It also can be called?(-)-trans-4-(4-Fluorophenyl)-3-hydroxymethyl-N-methylpiperidine?; (3S,4R)-4-(4-Fluorophenyl)-1-methyl-3-piperidinemethanol ; [(3S,4R)-4-(4-Fluorophenyl)-1-methylpiperidin-3-yl]methanol ;?(3S)-4-(4'-Fluorophenyl)-3-hydroxymethyl-1-methylpiperidine .?3-Piperidinemethanol,4-(4-fluorophenyl)-1-methyl-, (3S,4R)- (CAS NO.105812-81-5)is harmful if swallowed.?and it's risk of serious damage to the eyes.?What's more, it is toxic to aquatic organisms and ?may cause long-term adverse effects in the aquatic environment. So you should wear eye / face protection .In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.? |
| Packinggroup: | III |
| Usage: | An intermediate in the synthesis of Paroxetine, a selective serotonin reuptake inhibitor. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
