| Identification | |
| Name: | 3-Piperidinol,1-(phenylmethyl)-, hydrochloride (1:1) |
| Synonyms: | 3-Piperidinol,1-(phenylmethyl)-, hydrochloride (9CI);3-Piperidinol, 1-benzyl-, hydrochloride(6CI); |
| CAS: | 105973-51-1 |
| Molecular Formula: | C12H17NO.HCl |
| Molecular Weight: | 227.73 |
| InChI: | InChI=1/C12H17NO/c14-12-7-4-8-13(10-12)9-11-5-2-1-3-6-11/h1-3,5-6,12,14H,4,7-10H2/p+1/t12-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 153.7 oC |
| Boiling Point: | 330.6 oC at 760 mmHg |
| Appearance: | Pale yellow to colorless transparent liquid |
| Specification: |
3-Piperidinol,1-(phenylmethyl)-, hydrochloride (1:1) , its cas register number is 105973-51-1. It also can be called 1-Benzylpiperidin-3-ol hydrochloride ; 1-Benzylpiperidin-3-ol hydrochloride (1:1) ; 1-Benzylpiperidin-3-olhydrochlorid ; 1-Benzyl-3-hydroxypiperidine hydrochloride ; 1-Benzyl-3-piperidinol hydrochloride . 3-Piperidinol,1-(phenylmethyl)-, hydrochloride (1:1) (CAS NO.105973-51-1) is irritating to eyes, respiratory system and skin. In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| Flash Point: | 153.7 oC |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
