Identification |
Name: | Octadecanoic acid,2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl ester |
Synonyms: | Stearicacid, 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl ester (8CI); Tetraethyleneglycol, monostearate (8CI); Awiwol AS 4; Tetraethylene glycolmonooctadecanoate, octadecanoate |
CAS: | 106-07-0 |
EINECS: | 203-358-8 |
Molecular Formula: | C26H52 O6 |
Molecular Weight: | 460.68748 |
InChI: | InChI=1/C26H52O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-26(28)32-25-24-31-23-22-30-21-20-29-19-18-27/h27H,2-25H2,1H3 |
Molecular Structure: |
![(C26H52O6) Stearicacid, 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl ester (8CI); Tetraethyleneglycol, monostea...](https://img1.guidechem.com/chem/e/dict/165/106-07-0.jpg) |
Properties |
Flash Point: | 163°C |
Boiling Point: | 541.6°Cat760mmHg |
Density: | 0.964g/cm3 |
Refractive index: | 1.46 |
Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Flash Point: | 163°C |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |