| Identification | |
| Name: | 1-Octanol,3,7-dimethyl- |
| CAS: | 106-21-8 |
| EINECS: | 203-374-5 |
| Molecular Formula: | C10H22 O |
| Molecular Weight: | 158.2832 |
| InChI: | InChI=1/C10H22O/c1-9(2)5-4-6-10(3)7-8-11/h9-11H,4-8H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 95°C |
| Density: | 0.824g/cm3 |
| Refractive index: | n20/D 1.436(lit.) |
| Specification: | Clear colorless liquid Safety Statements:23-26-36 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 95°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
