| Identification | |
| Name: | 2,6-Octadien-1-ol,3,7-dimethyl-, (2Z)- |
| Synonyms: | cis-Geraniol;b-Nerol;2,6-Octadien-1-ol,3,7-dimethyl-, (Z)- (8CI);Nerol (6CI);(2Z)-3,7-Dimethyl-2,6-octadien-1-ol;(Z)-3,7-Dimethyl-2,6-octadien-1-ol;(Z)-Geraniol;(Z)-Nerol;2-cis-3,7-Dimethyl-2,6-octadien-1-ol;3,7-Dimethyl-cis-2,6-octadien-1-ol;Nerol900;Neryl alcohol;cis-3,7-Dimethyl-2,6-octadien-1-ol; |
| CAS: | 106-25-2 |
| EINECS: | 203-378-7 |
| Molecular Formula: | C10H18O |
| Molecular Weight: | 154.25 |
| InChI: | InChI=1/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,7,11H,4,6,8H2,1-3H3/b10-7+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | 175kgs |
| Melting Point: | < -10 C |
| Flash Point: | 98 - 101 C |
| Density: | 0.87 |
| Refractive index: | n20/D 1.474(lit.) |
| Water Solubility: | Insoluble (> 0.1g/100ml) |
| Solubility: | Insoluble (> 0.1g/100ml) |
| Appearance: | Clear liquid |
| Specification: | Clear colorless to almost colorless liquid Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 98 - 101 C |
| Color: | Colorless to pale-yellow, liquid oil Oily liquid |
| Safety Data | |
| Hazard Symbols | |
 |
|
