| Identification | |
| Name: | 4-Bromochlorobenzene |
| Synonyms: | 1,4-BROMOCHLOROBENZENE(PRACT); 1-bromo-4-chlorobenzene; p-Chlorobromobenzene |
| CAS: | 106-39-8 |
| EINECS: | 203-392-3 |
| Molecular Formula: | C6H4BrCl |
| Molecular Weight: | 191.45 |
| InChI: | InChI=1/C6H4BrCl/c7-5-1-3-6(8)4-2-5/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1230 3/PG 2 |
| Flash Point: | 70 C |
| Density: | 1.651 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1,496-1,498 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | white crystals |
| Specification: | white to almost white crystalline powder Safety Statements:26-36-37/39-37-45-36/37 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection 37:Wear suitable gloves 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37:Wear suitable protective clothing and gloves |
| HS Code: | 29036990 |
| Flash Point: | 70 C |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
