| Identification | |
| Name: | 4-Chlorothiophenol |
| Synonyms: | 4-Chlorobenzenethiol; 4-Chlorothiophenol/4-Chlorobenzenethiol; 4-Cyano-Acetophonene/4-CA; 4-Chloro thiophenol; Benzenethiol, p-chloro-; p-Chlorobenzenethiol; p-Chlorophenylmercaptan; p-Chlorothiophenol; p-Mercaptochlorobenzene; 1-Chloro-4-mercaptobenzene; 4-Chlorophenylmercaptan; 4-Chlorothiophenol; p-Chlorthiofenol; Phenyl mercaptan, p-chloro- |
| CAS: | 106-54-7 |
| EINECS: | 203-408-9 |
| Molecular Formula: | C6H5ClS |
| Molecular Weight: | 144.62 |
| InChI: | InChI=1/C6H5ClS/c7-5-1-3-6(8)4-2-5/h1-4,8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1759 |
| Density: | 1.268 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.5480 (20 C) |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | white to almost white crystalline solid |
| Specification: |
4-Chlorobenzenethiol (CAS NO.106-54-7), its Synonyms are 4-Chlorophenylmercaptan ; 4-Chlorothiophenol ; Phenyl mercaptan, p-chloro- ; p-Chlorobenzenethiol ; p-Chlorophenylmercaptan ; p-Chlorothiophenol ; p-Chlorthiofenol ; p-Mercaptochlorobenzene ; 1-Chloro-4-mercaptobenzene ; Benzenethiol, 4-chloro- ; Benzenethiol, p-chloro- . |
| Report: |
Chlorophenol compounds are on the Community Right-To-Know List. Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Stench/Lachrymatory |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
