| Identification | |
| Name: | Piperazine,2,5-dimethyl- |
| Synonyms: | - |
| CAS: | 106-55-8 |
| EINECS: | 203-409-4 |
| Molecular Formula: | C6H14N2 |
| Molecular Weight: | 114.19 |
| InChI: | InChI=1/C6H14N2/c1-5-3-8-6(2)4-7-5/h5-8H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.824 g/cm3 |
| Appearance: | Gray power |
| Specification: | Safety Statements:45-36/37/39-26-16 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 16:Keep away from sources of ignition - No smoking |
| Safety Data | |
| Hazard Symbols |
F: Flammable
C: Corrosive
|
 |
|
