| Identification | |
| Name: | 2,5-Piperazinedione |
| Synonyms: | 2,5-Diketopiperazine;2,5-Dioxopiperazine;Cyclo(glycylglycyl);Cyclodiglycine;Cycloglycylglycine;Diglycolyl diamide;Diketopiperazine;Glycine, N-glycyl-, cyclic peptide;Glycine, bimol. cyclic peptide;Glycylglycine lactam;NSC 26345;alpha,gamma-Diacipiperazine; |
| CAS: | 106-57-0 |
| EINECS: | 203-411-5 |
| Molecular Formula: | C4H6N2O2 |
| Molecular Weight: | 114.10 |
| InChI: | InChI=1/C4H6N2O2/c7-3-1-5-4(8)2-6-3/h1-2H2,(H,5,8)(H,6,7) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.246g/cm3 |
| Refractive index: | 1.467 |
| Appearance: | white to slightly yellow crystalline powder |
| Specification: | white to slightly yellow crystalline powder Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Safety Data | |
 |
|
