| Identification | |
| Name: | 3-Octanone |
| Synonyms: | EAK; n-Amyl ethyl ketone~Ethyl n-pentyl ketone; ethyl pentyl ketone; n-Amyl ethyl ketone; 3-oxooctane; Ethyl n-pentyl ketone; ethyln-pentylketone; n-Octanone-3; octan-3-; Octan-3-One; ETHYL AMYL KETONE |
| CAS: | 106-68-3 |
| EINECS: | 203-423-0 |
| Molecular Formula: | C8H16O |
| Molecular Weight: | 128.21 |
| InChI: | InChI=1/C8H16O/c1-4-7(3)6-8(9)5-2/h7H,4-6H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2271 |
| Density: | 0.822 |
| Refractive index: | 1.414-1.416 |
| Water Solubility: | 0.7 g/L |
| Solubility: | 0.7 g/L |
| Appearance: | Clear colourless to slightly yellow liquid |
| Specification: |
A clear colorless liquid with a pungent odor. Insoluble in water and partially soluble in alcohol. Flash point of 138°F. Vapors are denser than air and may have a narcotic effect in high concentrations. Used in making perfumes and as a solvent for nitrocellulose and vinyl resins. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
