| Identification | |
| Name: | 2-Propenoic acid,2-cyanoethyl ester |
| Synonyms: | Acrylicacid, ester with hydracrylonitrile (7CI,8CI); Hydracrylonitrile, acrylate(ester) (8CI); 2-Cyanoethyl acrylate; 2-Cyanoethyl propenoate; NSC 18593 |
| CAS: | 106-71-8 |
| EINECS: | 203-426-7 |
| Molecular Formula: | C6H7 N O2 |
| Molecular Weight: | 125.14 |
| InChI: | InChI=1/C6H7NO2/c1-2-6(8)9-5-3-4-7/h2H,1,3,5H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3276 |
| Melting Point: | -16.9 |
| Flash Point: | 100.4°C |
| Boiling Point: | 232.6°Cat760mmHg |
| Density: | 1.046g/cm3 |
| Refractive index: | 1.436 |
| Solubility: | Soluble in water |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | II |
| Flash Point: | 100.4°C |
| Color: | Liquid |
| Safety Data | |
 |
|
