Identification |
Name: | 2-Propenoic acid,2-cyanoethyl ester |
Synonyms: | Acrylicacid, ester with hydracrylonitrile (7CI,8CI); Hydracrylonitrile, acrylate(ester) (8CI); 2-Cyanoethyl acrylate; 2-Cyanoethyl propenoate; NSC 18593 |
CAS: | 106-71-8 |
EINECS: | 203-426-7 |
Molecular Formula: | C6H7 N O2 |
Molecular Weight: | 125.14 |
InChI: | InChI=1/C6H7NO2/c1-2-6(8)9-5-3-4-7/h2H,1,3,5H2 |
Molecular Structure: |
 |
Properties |
Transport: | 3276 |
Melting Point: | -16.9 |
Flash Point: | 100.4°C |
Boiling Point: | 232.6°Cat760mmHg |
Density: | 1.046g/cm3 |
Refractive index: | 1.436 |
Solubility: | Soluble in water |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Packinggroup: | II |
Flash Point: | 100.4°C |
Color: | Liquid |
Safety Data |
|
 |