| Identification | |
| Name: | 2,6-dimethyl-5-hepten-1-al |
| Synonyms: | Dimethylheptenal; 70%; melonal |
| CAS: | 106-72-9 |
| EINECS: | 203-427-2 |
| Molecular Formula: | C9H16O |
| Molecular Weight: | 140.22 |
| InChI: | InChI=1/C9H16O/c1-8(2)5-4-6-9(3)7-10/h5,7,9H,4,6H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1987 |
| Melting Point: | -23 |
| Flash Point: | 141? |
| Density: | 0.845 |
| Stability: | No data. |
| Refractive index: | 1.444 |
| Appearance: | Clear colorless liquid. |
| Specification: |
2,6-Dimethyl-5-heptenal (CAS NO.106-72-9), its Synonyms are 2,6-Dimethyl-2-hepten-7-al ; 2,6-Dimethyl-5-heptenal (natural) ; 2,6-Dimethylhept-5-en-1-al ; 5-Heptenal, 2,6-dimethyl- ; Melonal ; Bergamal . |
| Packinggroup: | III |
| Flash Point: | 141? |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
