| Identification | |
| Name: | Heptanoic acid, methylester |
| Synonyms: | Methylenanthate; Methyl heptanoate; Methyl heptoate; Methyl n-heptanoate; Methyln-heptylate; Methyl oenanthylate; Radia 30159 |
| CAS: | 106-73-0 |
| EINECS: | 203-428-8 |
| Molecular Formula: | C8H16 O2 |
| Molecular Weight: | 144.21 |
| InChI: | InChI=1/C8H16O2/c1-3-4-5-6-7-8(9)10-2/h3-7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3272 |
| Density: | 0.87 |
| Refractive index: | 1.411 |
| Specification: | clear colorless liquid Safety Statements:16-26-36 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
