| Identification | |
| Name: | Dimethyl sebacate |
| Synonyms: | Decanedioicacid, dimethyl ester (9CI);Sebacic acid, dimethyl ester (6CI,8CI);Dimethyldecane-1,10-dioate;Dimethyl octane-1,8-dicarboxylate;Dimethyldecanedioate;NSC 9415;Decanedioic acid,1,10-dimethyl ester; |
| CAS: | 106-79-6 |
| EINECS: | 203-431-4 |
| Molecular Formula: | C12H22O4 |
| Molecular Weight: | 230.3 |
| InChI: | InChI=1/C12H22O4/c1-15-11(13)9-7-5-3-4-6-8-10-12(14)16-2/h3-10H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 200kgs |
| Density: | 0.988 |
| Stability: | Stable. Incompatible with oxidizing agents, bases. Combustible. |
| Refractive index: | 1.4355 (28 C) |
| Solubility: | Insoluble |
| Appearance: | clear liquid |
| Specification: | colourless melt or liquid Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Packinggroup: | Z01 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Plasticizer. |
| Safety Data | |
 |
|
