| Identification | |
| Name: | 2-Propenoic acid,ammonium salt (1:1) |
| Synonyms: | 2-Propenoicacid, ammonium salt (9CI); Acrylic acid, ammonium salt (8CI); Ammonium acrylate |
| CAS: | 10604-69-0 |
| EINECS: | 234-229-4 |
| Molecular Formula: | C3H4 O2 . H3 N |
| Molecular Weight: | 89.09 |
| InChI: | InChI=1/C3H4O2.H3N/c1-2-3(4)5;/h2H,1H2,(H,4,5);1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 12.5 deg C |
| Flash Point: | 61.6°C |
| Boiling Point: | 141°Cat760mmHg |
| Density: | 1.063g/cm3 |
| Solubility: | Miscible with alcohol, and ether Miscible with ethanol, ethyl ether; soluble in acetone, benzene, carbon tetrachloride Miscible with chloroform Miscible with water /1X10+6 mg/L/ at 25 deg C |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 61.6°C |
| Color: | Volatile liquid Colorless liquid Colorless liquid or solid (below 55 degrees F) |
| Safety Data | |
 |
|
