| Identification | ||
| Name: | carbendazim | |
| Synonyms: | methyl benzimidazol-2-ylcarbamate; Methyl-1H-benzimidazol-2-yl carbamate; Carbendazol; Bavistin; Derosal; Delsene; Methyl 2-benzimidazolecarbamate; 1H-Benzimidazole-2-carbamic acid methyl ester; 2-Benzimidazolecarbamic acid methyl ester; 2-(Carbomethoxyamino)benzimidazole; BCM ; N-(benzimidazlyl-2)methyl carbamate(effective constituent) | |
| CAS: | 10605-21-7 | |
| EINECS: | 234-232-0 | |
| Molecular Formula: | C9H9N3O2 | |
| Molecular Weight: | 191.19 | |
| InChI: | InChI=1/C9H9N3O2/c1-14-9(13)12-8-10-6-4-2-3-5-7(6)11-8/h2-5H,1H3,(H2,10,11,12,13) | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | UN 3077 | |
| Boiling Point: | 409 | |
| Density: | 1.421g/cm3 | |
| Stability: | No data. | |
| Water Solubility: | <0.1 g/100 mL at 21 ºC | |
| Appearance: | Light gray or beige powder | |
| Specification: |
?Carbendazim (CAS NO.10605-21-7) is a carbamate ester-amine. Amines behave as chemical bases. Carbamates are chemically similar to, but more reactive than amides. Like amides they form polymers such as polyurethane resins. Carbamates are incompatible with strong acids and bases, and especially incompatible with strong reducing agents such as hydrides. Flammable gaseous hydrogen is produced by the combination of active metals or nitrides with carbamates. Strongly oxidizing acids, peroxides, and hydroperoxides are incompatible with carbamates. | |
| Color: | Light-gray powder. White solid /Technical Grade/ | |
| Usage: | Fungicide. | |
| Safety Data | ||
| Hazard Symbols |
T:Toxic
|
|
 |
||
