| Identification | |
| Name: | Propanoic acid,3-methoxy-, ethyl ester |
| Synonyms: | Propionicacid, 3-methoxy-, ethyl ester (6CI,7CI,8CI); Ethyl 3-methoxypropanoate; Ethyl3-methoxypropionate |
| CAS: | 10606-42-5 |
| Molecular Formula: | C6H12 O3 |
| Molecular Weight: | 132.18 |
| InChI: | InChI=1/C6H12O3/c1-3-9-6(7)4-5-8-2/h3-5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 52.5°C |
| Boiling Point: | 166.7°Cat760mmHg |
| Density: | 0.961g/cm3 |
| Refractive index: | 1.4 |
| Specification: |
Ethyl 3-methoxypropionate , its cas register number is10606-42-5. It also can be called 4-03-00-00697 (Beilstein Handbook Reference) ; AI3-03239 ; BRN 1748684 ; Ethyl 3-methoxypropanoate . Ethyl 3-methoxypropionate (CAS NO.10606-42-5) is irritating to eyes, respiratory system and skin. So you should wear suitable protective clothing, gloves and eye/face protection. In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| Flash Point: | 52.5°C |
| Safety Data | |
 |
|
