Identification |
Name: | 2,6-Benzothiazolediamine,4,5,6,7-tetrahydro-, (6R)- |
Synonyms: | 2,6-Benzothiazolediamine,4,5,6,7-tetrahydro-, (R)-;(R)-2,6-Diamino-4,5,6,7-tetrahydrobenzothiazole;(R)-4,5,6,7-Tetrahydrobenzothiazole-2,6-diamine;MolPort-002-501-553;AC-20378;R-(+)-2,6-Diamino-4,5,6,7- tetrahydrobenzothiazole; |
CAS: | 106092-11-9 |
Molecular Formula: | C7H11N3S |
Molecular Weight: | 169.24 |
InChI: | InChI=1/C7H11N3S/c8-4-1-2-5-6(3-4)11-7(9)10-5/h4H,1-3,8H2,(H2,9,10)/t4-/m1/s1 |
Molecular Structure: |
 |
Properties |
Flash Point: | 170.9°C |
Boiling Point: | 359°Cat760mmHg |
Density: | 1.313g/cm3 |
Refractive index: | 1.655 |
Appearance: | off-white solid |
Flash Point: | 170.9°C |
Usage: |
2,6-Benzothiazolediamine,4,5,6,7-tetrahydro-, (6R)- ,whose cas register No. is 106092-11-9),can be used as intermediate of (R)-pramipexole.
|
Safety Data |
|
 |