| Identification |
| Name: | 1-Piperidinecarbothioamide,N-cyclohexyl-4-(1H-imidazol-5-yl)- |
| Synonyms: | 1-Piperidinecarbothioamide,N-cyclohexyl-4-(1H-imidazol-4-yl)- (9CI); MR 12842; Thioperamide |
| CAS: | 106243-16-7 |
| Molecular Formula: | C15H24 N4 S |
| Molecular Weight: | 292.44286 |
| InChI: | InChI=1S/C15H24N4S/c20-15(18-13-4-2-1-3-5-13)19-8-6-12(7-9-19)14-10-16-11-17-14/h10-13H,1-9H2,(H,16,17)(H,18,20) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.2 g/cm3 |
| Refractive index: | 1.614 |
| Water Solubility: | Soluble to 50 mM in water |
| Solubility: | Soluble to 50 mM in water |
| Appearance: | White Solid |
| Biological Activity: | Potent histamine H 3 and H 4 antagonist/inverse agonist. K i values are 25 and 27 nM for human recombinant H 3 and H 4 receptors respectively. Blocks eosinophil shape change (IC 50 = 1.4 μ M) and chemotaxis (IC 50 = 519 nM) induced by histamine. Freely crosses the blood-brain barrier. Also available as part of the Histamine H 3 Receptor Tocriset™ . |
| Color: | white |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
