| Identification | |
| Name: | 1H-1,2,3-Triazole-4-carboxamide,1-[(2,6-difluorophenyl)methyl]- |
| Synonyms: | CGP 33101;E 2080;Inovelon;RUF 331;1-(2,6-Difluorobenzyl)-1H-1,2,3-triazole-4-carboxamide; |
| CAS: | 106308-44-5 |
| Molecular Formula: | C10H8F2N4O |
| Molecular Weight: | 238.19 |
| InChI: | InChI=1/C10H8F2N4O/c11-7-2-1-3-8(12)6(7)4-16-5-9(10(13)17)14-15-16/h1-3,5H,4H2,(H2,13,17) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.52 g/cm3 |
| Refractive index: | 1.634 |
| Appearance: | white powder |
| Specification: |
1H-1,2,3-Triazole-4-carboxamide,1-[(2,6-difluorophenyl)methyl]- , its cas register number is 106308-44-5. It also can be called Rufinamide ; and 1-(2,6-Difluorobenzyl)-1H-1,2,3-triazole-4-carboxamide . Its classification code are Antiepileptic; Treatment of partial-onset seizures and Treatment of seizures in Lennox-Gastaut syndrome. |
| Biological Activity: | Board spectrum anticonvulsant. Prolongs the inactivation of sodium channels and limits the frequency of action potential firing in cultured and acutely isolated neurons. Displays anticonvulsive activity in a range of animal seizure models. |
| Storage Temperature: | −20°C |
| Safety Data | |
 |
|
