| Identification | |
| Name: | Divinyloxyethane |
| Synonyms: | 1,5-Hexadiene-3,4-diol,mixture of (? and meso; hexa-1,5-diene-3,4-diol; 1,2-Divinyl Glycol; 3,4-Dihydroxy-1,5-hexadiene; 1,5-Hexadiene-3,4-diol; Aldehyde C9; 4-Dimethoxy-4-Xylene Dimethyl Ether; Divinyl glycol |
| CAS: | 1069-23-4 |
| EINECS: | 213-955-5 |
| Molecular Formula: | C6H10O2 |
| Molecular Weight: | 114.14 |
| InChI: | InChI=1/C6H10O2/c1-3-5(7)6(8)4-2/h3-8H,1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Flash Point: | 199? |
| Density: | 1.02 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.479 |
| Solubility: | Soluble |
| Appearance: | Light yellow oily liquid |
| Packinggroup: | III |
| HS Code: | 29053980 |
| Flash Point: | 199? |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from light. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
