| Identification | |
| Name: | 1-Iodopropane |
| Synonyms: | 1-Iodopropane, stabilized over copper; iodopropane; n-Propyl iodide; propyl iodide; n-Propyliodid; IsopropylIodide; 1-butyl iodide; n-iodobutane |
| CAS: | 107-08-4 |
| EINECS: | 203-460-2 |
| Molecular Formula: | C3H7I |
| Molecular Weight: | 169.99 |
| InChI: | InChI=1/C3H7I/c1-3(2)4/h3H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2392 |
| Density: | 1.749 |
| Stability: | Stable, but may discolour on exposure to light. Incompatible with strong oxidizing agents, strong bases. Flammable. |
| Refractive index: | 1.5058 |
| Water Solubility: | slightly soluble in Water |
| Solubility: | slightly soluble in Water |
| Appearance: | colorless transparent liquid |
| Specification: | colourless liquid Safety Statements:16-26-36/37-61 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37:Wear suitable protective clothing and gloves 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Packinggroup: | III |
| HS Code: | 29033080 |
| Storage Temperature: | Flammables area |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
