| Identification | |
| Name: | 2-Bromopentane |
| Synonyms: | Bromopentane; 1-methylbutyl bromide; 2-bromo-pentan; 2-Pentylbromid; pentane,2-bromo-; SEC-AMYL BROMIDE; (+/-)-2-PENTYL BROMIDE; 2-PENTYL BROMIDE; (+/-)-2-BROMOPENTANE |
| CAS: | 107-81-3 |
| EINECS: | 203-521-3 |
| Molecular Formula: | C5H11Br |
| Molecular Weight: | 151.04 |
| InChI: | InChI=1/C5H11Br/c1-3-4-5(2)6/h5H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2343 |
| Density: | 1.208 |
| Stability: | Stable. Highly flammable. Incompatible with strong bases, strong oxidizing agents. |
| Refractive index: | 1.4393-1.4413 |
| Water Solubility: | practically insoluble |
| Solubility: | AUTOIGNITION |
| Appearance: | clear to yellow liquid |
| Specification: | colourless liquid Safety Statements:16-26-36/37/39 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
F:Flammable
Xi:Irritant
|
 |
|
