| Identification | |
| Name: | 3-methylcrotonaldehyde |
| Synonyms: | 3-Methyl-2-butenal; senecialdehyde; Prenal; 3,3-Dimethylacrolein |
| CAS: | 107-86-8 |
| EINECS: | 203-527-6 |
| Molecular Formula: | C5H8O |
| Molecular Weight: | 84.12 |
| InChI: | InChI=1/C5H8O/c1-5(2)3-4-6/h3-4H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1989 |
| Density: | 0.88 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.461-1.463 |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | Pale yellow to reddish liquid. |
| Specification: | clear colorless to light yellow liquid Safety Statements:26-36-37/39-16 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection 16:Keep away from sources of ignition - No smoking |
| Packinggroup: | III |
| Storage Temperature: | 2-8°C |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
