| Identification | |
| Name: | 2-Pentanone |
| Synonyms: | Methyl propyl ketone; METHYL N-PROPYLKETON; METHYL N-PROPYL KETONE; ETHYLACETONE; FEMA 2842; PENTAN-2-ONE; 2-Oxopentane; 2-Pentanon |
| CAS: | 107-87-9 |
| EINECS: | 203-528-1 |
| Molecular Formula: | C5H10O |
| Molecular Weight: | 86.13 |
| InChI: | InChI=1/C5H10O/c1-3-4-5(2)6/h3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1249 |
| Density: | 0.8095 |
| Stability: | Stable. Highly flammable - note low flashpoint. Incompatible with strong bases, oxidizing agents, reducing agents. |
| Refractive index: | 1.389-1.391 |
| Solubility: | soluble in water |
| Appearance: | clear colorless liquid with the odor of fingernail polish |
| Specification: |
?2-Pentanone , its cas register number is 107-87-9. It also can be called?Methyl propyl ketone?; Ethyl acetone ; Methyl n-propyl ketone ; Methyl propyl ketone ; Methyl-propyl-cetone ; Metylopropyloketon [Polish] ; Propyl methyl ketone .It is a clear colorless liquid with the odor of fingernail polish. It?less dense than water and soluble in water.It is?highly flammable and can soluble in water. It?is incompatible with oxidizing agents, strong bases and reducing agents. Reacts violently with bromine trifluoride. |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Color: | Colorless liquid Colorless to water-white liquid |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
