| Identification |
| Name: | Acetopropyl alcohol |
| Synonyms: | 3-Acetopropanol;3-Acetyl-1-propanol;3-Acetylpropanol;4-Oxo-1-pentanol;5-Hydroxy-2-pentanone;NSC 19158;NSC 33940;g-Acetopropanol;g-Acetopropyl alcohol;2-Pentanone, 5-hydroxy-; |
| CAS: | 1071-73-4 |
| EINECS: | 213-994-8 |
| Molecular Formula: | C5H10O2 |
| Molecular Weight: | 102.13 |
| InChI: | InChI=1/C5H10O2/c1-5(7)3-2-4-6/h6H,2-4H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 33562 |
| Density: | 1.007 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.437-1.44 |
| Solubility: | Very soluble |
| Appearance: | clear colorless liquid |
| Packinggroup: | O52 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
