| Identification | |
| Name: | Ethanone,1-(1H-pyrrol-2-yl)- |
| Synonyms: | Ketone,methyl 2-pyrryl (4CI);Ketone, methyl pyrrol-2-yl (6CI,7CI,8CI);(2-Pyrrolyl)ethanone;1-(1H-Pyrrol-2-yl)ethanone;1-(2-Pyrrolyl)-1-ethanone;2-Acetyl-1H-indole;2-Acetyl-1H-pyrrole;2-Acetylpyrrole;2-Pyrrolyl methylketone;Methyl pyrrol-2-yl ketone;NSC 42861;2- acetyl pyrrole; |
| CAS: | 1072-83-9 |
| EINECS: | 214-016-2 |
| Molecular Formula: | C6H7NO |
| Molecular Weight: | 109.13 |
| InChI: | InChI=1/C6H7NO/c1-5(8)6-3-2-4-7-6/h2-4,7H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.099 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.53 |
| Water Solubility: | Soluble in hot water (Soluble in alcohol) |
| Solubility: | Soluble in hot water (Soluble in alcohol) |
| Appearance: | white to beige crystalline powder |
| Specification: |
?2-Acetylpyrrole (CAS NO.1072-83-9), its Synonyms are 1-(1H-Pyrrol-2-yl)ethanone ; 1-(2-Pyrrolyl)-1-ethanone ; 2-Acetyl-1H-pyrrole ; 2-Pyrrolyl methyl ketone ; 2-Pyrrolylethanone ; Ethanone, 1-(1H-pyrrol-2-yl)- ; Ketone, methyl pyrrol-2-yl ; Methyl pyrrol-2-yl ketone . |
| HS Code: | 29339990 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
Xi: Irritant
|
 |
|
