| Identification |
| Name: | 2-Amino-5-bromopyridine |
| Synonyms: | 5-bromo-2-pyridylamine; 5-Bromopyridin-2-amine; 4-AMINO-5-CHLORO-2,1,3-BENZOTHIODIAZOLE |
| CAS: | 1072-97-5 |
| EINECS: | 214-019-9 |
| Molecular Formula: | C5H5BrN2 |
| Molecular Weight: | 173.0106 |
| InChI: | InChI=1S/C5H5BrN2/c6-4-1-2-5(7)8-3-4/h1-3H,(H2,7,8) |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2811 6 |
| Density: | 1.71 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | Insoluble in water |
| Solubility: | Insoluble in water |
| Appearance: | colorless liquid / off white to light to power |
| HS Code: | 29333999 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
