| Identification |
| Name: | 2-Amino-5-chloropyridine |
| Synonyms: | AI3-52448;2-Pyridinamine, 5-chloro-;5-Chloro-2-pyridylamine; |
| CAS: | 1072-98-6 |
| EINECS: | 214-020-4 |
| Molecular Formula: | C5H5ClN2 |
| Molecular Weight: | 128.56 |
| InChI: | InChI=1/C5H5ClN2/c6-4-1-2-5(7)8-3-4/h1-3H,(H2,7,8) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.326 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | 1 g/L (20 oC) |
| Appearance: | similar to white powder crystal |
| HS Code: | 29333999 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
