| Identification |
| Name: | 4-Chlorostyrene |
| Synonyms: | Chlorostyrene; 98% |
| CAS: | 1073-67-2 |
| EINECS: | 214-028-8 |
| Molecular Formula: | C8H7Cl |
| Molecular Weight: | 138.59 |
| InChI: | InChI=1/C8H7Cl/c1-2-7-3-5-8(9)6-4-7/h2-6H,1H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1993 |
| Density: | 1.155 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5645-1.5665 |
| Solubility: | Insoluble |
| Appearance: | Clear, colorless liquid. |
| Packinggroup: | III |
| HS Code: | 29036990 |
| Usage: | P-chlorostyrene is used in the manufacture of polychlorostyrene which is a clear, colorless plastic with good foaming, heat distortion and flame-retardant properties. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
