Identification |
Name: | 4-Chlorostyrene |
Synonyms: | Chlorostyrene; 98% |
CAS: | 1073-67-2 |
EINECS: | 214-028-8 |
Molecular Formula: | C8H7Cl |
Molecular Weight: | 138.59 |
InChI: | InChI=1/C8H7Cl/c1-2-7-3-5-8(9)6-4-7/h2-6H,1H2 |
Molecular Structure: |
 |
Properties |
Transport: | UN 1993 |
Density: | 1.155 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.5645-1.5665 |
Solubility: | Insoluble |
Appearance: | Clear, colorless liquid. |
Packinggroup: | III |
HS Code: | 29036990 |
Usage: | P-chlorostyrene is used in the manufacture of polychlorostyrene which is a clear, colorless plastic with good foaming, heat distortion and flame-retardant properties. |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |